C13H22O6Si — CID 156766204
3-trimethoxysilylpropyl 5-methyl-4-oxohexa-2,5-dienoate (PubChem CID 156766204) has the molecular formula C13H22O6Si and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-trimethoxysilylpropyl 5-methyl-4-oxohexa-2,5-dienoate.
| Compound Name | 3-trimethoxysilylpropyl 5-methyl-4-oxohexa-2,5-dienoate |
|---|---|
| PubChem CID | 156766204 |
| Molecular Formula | C13H22O6Si |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-trimethoxysilylpropyl 5-methyl-4-oxohexa-2,5-dienoate |
| SMILES | C=C(C)C(=O)C=CC(=O)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C13H22O6Si/c1-11(2)12(14)7-8-13(15)19-9-6-10-20(16-3,17-4)18-5/h7-8H,1,6,9-10H2,2-5H3 |
| InChIKey | HRUDZIKNELZCPE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|