C23H40O4Si2 — CID 10717809
(5Z)-5-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-3-[(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxypenta-1,3-dienyl]furan-2-one (PubChem CID 10717809) has the molecular formula C23H40O4Si2 and a molecular weight of 436.74 g/mol. Its IUPAC name is (5Z)-5-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-3-[(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxypenta-1,3-dienyl]furan-2-one.
| Compound Name | (5Z)-5-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-3-[(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxypenta-1,3-dienyl]furan-2-one |
|---|---|
| PubChem CID | 10717809 |
| Molecular Formula | C23H40O4Si2 |
| Molecular Weight | 436.74 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (5Z)-5-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-3-[(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxypenta-1,3-dienyl]furan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C1/C=C(/C=C/C=C/CO[Si](C)(C)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C23H40O4Si2/c1-22(2,3)28(7,8)25-16-13-11-12-14-19-18-20(27-21(19)24)15-17-26-29(9,10)23(4,5)6/h11-15,18H,16-17H2,1-10H3/b13-11+,14-12+,20-15- |
| InChIKey | OPXZXWDHUMBOPG-XQWFHAJTSA-N |
| XLogP | 6.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.74 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|