C42H54N2O18 — CID 135062914
(5,7,24,25,26-pentaacetyloxy-3,28-dioxo-9,22,35,36-tetraoxa-2,29-diazatetracyclo[28.2.2.14,8.123,27]hexatriaconta-1(33),30(34),31-trien-15-yn-6-yl) acetate (PubChem CID 135062914) has the molecular formula C42H54N2O18 and a molecular weight of 874.89 g/mol. Its IUPAC name is (5,7,24,25,26-pentaacetyloxy-3,28-dioxo-9,22,35,36-tetraoxa-2,29-diazatetracyclo[28.2.2.14,8.123,27]hexatriaconta-1(33),30(34),31-trien-15-yn-6-yl) acetate.
| Compound Name | (5,7,24,25,26-pentaacetyloxy-3,28-dioxo-9,22,35,36-tetraoxa-2,29-diazatetracyclo[28.2.2.14,8.123,27]hexatriaconta-1(33),30(34),31-trien-15-yn-6-yl) acetate |
|---|---|
| PubChem CID | 135062914 |
| Molecular Formula | C42H54N2O18 |
| Molecular Weight | 874.89 g/mol |
| Exact Mass | 874.34 |
| IUPAC Name | (5,7,24,25,26-pentaacetyloxy-3,28-dioxo-9,22,35,36-tetraoxa-2,29-diazatetracyclo[28.2.2.14,8.123,27]hexatriaconta-1(33),30(34),31-trien-15-yn-6-yl) acetate |
| SMILES | CC(=O)OC1C2OCCCCCC#CCCCCCOC3OC(C(=O)Nc4ccc(cc4)NC(=O)C(O2)C(OC(C)=O)C1OC(C)=O)C(OC(C)=O)C(OC(C)=O)C3OC(C)=O |
| InChI | InChI=1S/C42H54N2O18/c1-23(45)55-31-33(57-25(3)47)37(59-27(5)49)41-53-21-15-13-11-9-7-8-10-12-14-16-22-54-42-38(60-28(6)50)34(58-26(4)48)32(56-24(2)46)36(62-42)40(52)44-30-19-17-29(18-20-30)43-39(51)35(31)61-41/h17-20,31-38,41-42H,9-16,21-22H2,1-6H3,(H,43,51)(H,44,52) |
| InChIKey | YTXFBOVLBPXPGJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 252.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.89 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|