C46H60N2O18 — CID 135071827
[3,5-diacetyloxy-2-oct-6-ynoxy-6-[[4-[(3,4,5-triacetyloxy-6-oct-6-ynoxyoxane-2-carbonyl)amino]phenyl]carbamoyl]oxan-4-yl] acetate (PubChem CID 135071827) has the molecular formula C46H60N2O18 and a molecular weight of 928.98 g/mol. Its IUPAC name is [3,5-diacetyloxy-2-oct-6-ynoxy-6-[[4-[(3,4,5-triacetyloxy-6-oct-6-ynoxyoxane-2-carbonyl)amino]phenyl]carbamoyl]oxan-4-yl] acetate.
| Compound Name | [3,5-diacetyloxy-2-oct-6-ynoxy-6-[[4-[(3,4,5-triacetyloxy-6-oct-6-ynoxyoxane-2-carbonyl)amino]phenyl]carbamoyl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 135071827 |
| Molecular Formula | C46H60N2O18 |
| Molecular Weight | 928.98 g/mol |
| Exact Mass | 928.38 |
| IUPAC Name | [3,5-diacetyloxy-2-oct-6-ynoxy-6-[[4-[(3,4,5-triacetyloxy-6-oct-6-ynoxyoxane-2-carbonyl)amino]phenyl]carbamoyl]oxan-4-yl] acetate |
| SMILES | CC#CCCCCCOC1OC(C(=O)Nc2ccc(NC(=O)C3OC(OCCCCCC#CC)C(OC(C)=O)C(OC(C)=O)C3OC(C)=O)cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C46H60N2O18/c1-9-11-13-15-17-19-25-57-45-41(63-31(7)53)37(61-29(5)51)35(59-27(3)49)39(65-45)43(55)47-33-21-23-34(24-22-33)48-44(56)40-36(60-28(4)50)38(62-30(6)52)42(64-32(8)54)46(66-40)58-26-20-18-16-14-12-10-2/h21-24,35-42,45-46H,13-20,25-26H2,1-8H3,(H,47,55)(H,48,56) |
| InChIKey | LRMSAEZYPLHIRW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 252.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.98 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|