C12H8N4O2 — CID 135062924
3-nitro-2-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 135062924) has the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 3-nitro-2-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-nitro-2-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 135062924 |
| Molecular Formula | C12H8N4O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 3-nitro-2-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | O=[N+]([O-])c1c(-c2ccncc2)[nH]c2ncccc12 |
| InChI | InChI=1S/C12H8N4O2/c17-16(18)11-9-2-1-5-14-12(9)15-10(11)8-3-6-13-7-4-8/h1-7H,(H,14,15) |
| InChIKey | BOPVKUNQIWUHNZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|