C29H27NO4S2 — CID 135064734
S-phenyl (2S,3S)-3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]-2-phenylpropanethioate (PubChem CID 135064734) has the molecular formula C29H27NO4S2 and a molecular weight of 517.67 g/mol. Its IUPAC name is S-phenyl (2S,3S)-3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]-2-phenylpropanethioate.
| Compound Name | S-phenyl (2S,3S)-3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]-2-phenylpropanethioate |
|---|---|
| PubChem CID | 135064734 |
| Molecular Formula | C29H27NO4S2 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | S-phenyl (2S,3S)-3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]-2-phenylpropanethioate |
| SMILES | COc1ccc([C@@H](NS(=O)(=O)c2ccc(C)cc2)[C@@H](C(=O)Sc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H27NO4S2/c1-21-13-19-26(20-14-21)36(32,33)30-28(23-15-17-24(34-2)18-16-23)27(22-9-5-3-6-10-22)29(31)35-25-11-7-4-8-12-25/h3-20,27-28,30H,1-2H3/t27-,28+/m0/s1 |
| InChIKey | HFVGFROUGPHLTO-WUFINQPMSA-N |
| XLogP | 6.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|