C21H36FNO2SSi — CID 135065207
[(2S,3R)-3-fluoro-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl-tri(propan-2-yl)silane (PubChem CID 135065207) has the molecular formula C21H36FNO2SSi and a molecular weight of 413.68 g/mol. Its IUPAC name is [(2S,3R)-3-fluoro-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl-tri(propan-2-yl)silane.
| Compound Name | [(2S,3R)-3-fluoro-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 135065207 |
| Molecular Formula | C21H36FNO2SSi |
| Molecular Weight | 413.68 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | [(2S,3R)-3-fluoro-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl-tri(propan-2-yl)silane |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H](F)[C@H]2C[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C21H36FNO2SSi/c1-15(2)27(16(3)4,17(5)6)14-21-20(22)12-13-23(21)26(24,25)19-10-8-18(7)9-11-19/h8-11,15-17,20-21H,12-14H2,1-7H3/t20-,21-/m1/s1 |
| InChIKey | PRFYMDFBYIIYJP-NHCUHLMSSA-N |
| XLogP | 5.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.68 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|