C24H22N2O4S2 — CID 135065420
3-methyl-1,4-bis-(4-methylphenyl)sulfonyl-5-phenylpyrazole (PubChem CID 135065420) has the molecular formula C24H22N2O4S2 and a molecular weight of 466.58 g/mol. Its IUPAC name is 3-methyl-1,4-bis-(4-methylphenyl)sulfonyl-5-phenylpyrazole.
| Compound Name | 3-methyl-1,4-bis-(4-methylphenyl)sulfonyl-5-phenylpyrazole |
|---|---|
| PubChem CID | 135065420 |
| Molecular Formula | C24H22N2O4S2 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 3-methyl-1,4-bis-(4-methylphenyl)sulfonyl-5-phenylpyrazole |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C)nn(S(=O)(=O)c3ccc(C)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O4S2/c1-17-9-13-21(14-10-17)31(27,28)24-19(3)25-26(23(24)20-7-5-4-6-8-20)32(29,30)22-15-11-18(2)12-16-22/h4-16H,1-3H3 |
| InChIKey | UVPBLUQLRLQLOV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |