C29H33N3O2S — CID 56680214
N-[2-(5-benzyl-3-phenyl-1H-pyrazol-4-yl)ethyl]-4-pentylbenzenesulfonamide (PubChem CID 56680214) has the molecular formula C29H33N3O2S and a molecular weight of 487.67 g/mol. Its IUPAC name is N-[2-(5-benzyl-3-phenyl-1H-pyrazol-4-yl)ethyl]-4-pentylbenzenesulfonamide.
| Compound Name | N-[2-(5-benzyl-3-phenyl-1H-pyrazol-4-yl)ethyl]-4-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 56680214 |
| Molecular Formula | C29H33N3O2S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | N-[2-(5-benzyl-3-phenyl-1H-pyrazol-4-yl)ethyl]-4-pentylbenzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)NCCc2c(-c3ccccc3)n[nH]c2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H33N3O2S/c1-2-3-6-11-23-16-18-26(19-17-23)35(33,34)30-21-20-27-28(22-24-12-7-4-8-13-24)31-32-29(27)25-14-9-5-10-15-25/h4-5,7-10,12-19,30H,2-3,6,11,20-22H2,1H3,(H,31,32) |
| InChIKey | GDFBLHMZFJWYAN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|