C26H29N3O2S2 — CID 11294571
4-pentyl-N-[2-(3-phenyl-5-thiophen-2-yl-1H-pyrazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 11294571) has the molecular formula C26H29N3O2S2 and a molecular weight of 479.67 g/mol. Its IUPAC name is 4-pentyl-N-[2-(3-phenyl-5-thiophen-2-yl-1H-pyrazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-pentyl-N-[2-(3-phenyl-5-thiophen-2-yl-1H-pyrazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11294571 |
| Molecular Formula | C26H29N3O2S2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-pentyl-N-[2-(3-phenyl-5-thiophen-2-yl-1H-pyrazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)NCCc2c(-c3ccccc3)n[nH]c2-c2cccs2)cc1 |
| InChI | InChI=1S/C26H29N3O2S2/c1-2-3-5-9-20-13-15-22(16-14-20)33(30,31)27-18-17-23-25(21-10-6-4-7-11-21)28-29-26(23)24-12-8-19-32-24/h4,6-8,10-16,19,27H,2-3,5,9,17-18H2,1H3,(H,28,29) |
| InChIKey | ZMUIUSVZADZYAZ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|