C16H24N4O2S2 — CID 20947610
5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-(3-pyrrolidin-1-ylpropyl)thiophene-2-sulfonamide (PubChem CID 20947610) has the molecular formula C16H24N4O2S2 and a molecular weight of 368.53 g/mol. Its IUPAC name is 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-(3-pyrrolidin-1-ylpropyl)thiophene-2-sulfonamide.
| Compound Name | 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-(3-pyrrolidin-1-ylpropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20947610 |
| Molecular Formula | C16H24N4O2S2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 5-(4,5-dimethyl-1H-pyrazol-3-yl)-N-(3-pyrrolidin-1-ylpropyl)thiophene-2-sulfonamide |
| SMILES | Cc1[nH]nc(-c2ccc(S(=O)(=O)NCCCN3CCCC3)s2)c1C |
| InChI | InChI=1S/C16H24N4O2S2/c1-12-13(2)18-19-16(12)14-6-7-15(23-14)24(21,22)17-8-5-11-20-9-3-4-10-20/h6-7,17H,3-5,8-11H2,1-2H3,(H,18,19) |
| InChIKey | XFKFWNYSZUSSFG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|