C24H16N2O2 — CID 135065422
1-benzofuran-2-yl-(3,4-diphenyl-1H-pyrazol-5-yl)methanone (PubChem CID 135065422) has the molecular formula C24H16N2O2 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(3,4-diphenyl-1H-pyrazol-5-yl)methanone.
| Compound Name | 1-benzofuran-2-yl-(3,4-diphenyl-1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 135065422 |
| Molecular Formula | C24H16N2O2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-benzofuran-2-yl-(3,4-diphenyl-1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1cc2ccccc2o1)c1[nH]nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H16N2O2/c27-24(20-15-18-13-7-8-14-19(18)28-20)23-21(16-9-3-1-4-10-16)22(25-26-23)17-11-5-2-6-12-17/h1-15H,(H,25,26) |
| InChIKey | GSDSAHXXGJGVPD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |