About (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone
(4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone (PubChem CID 135065560) has the molecular formula C23H28ClNO3S
and a molecular weight of 434.00 g/mol. Its IUPAC name is (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone.
Molecular Properties
| Compound Name | (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone |
| PubChem CID | 135065560 |
| Molecular Formula | C23H28ClNO3S |
| Molecular Weight | 434.00 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone |
| SMILES | CCCCCC[C@H]1C[C@@H](C(=O)c2ccc(Cl)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H28ClNO3S/c1-3-4-5-6-7-20-16-22(23(26)18-10-12-19(24)13-11-18)25(20)29(27,28)21-14-8-17(2)9-15-21/h8-15,20,22H,3-7,16H2,1-2H3/t20-,22-/m0/s1 |
| InChIKey | LVJHFVDKZZLIPN-UNMCSNQZSA-N |
| XLogP | 5.63 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.00 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone?
The IUPAC name of (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone (CID 135065560) is (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone.
What is the SMILES notation for (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone?
The canonical SMILES for (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone is CCCCCC[C@H]1C[C@@H](C(=O)c2ccc(Cl)cc2)N1S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone?
The InChIKey is LVJHFVDKZZLIPN-UNMCSNQZSA-N. The full InChI is InChI=1S/C23H28ClNO3S/c1-3-4-5-6-7-20-16-22(23(26)18-10-12-19(24)13-11-18)25(20)29(27,28)21-14-8-17(2)9-15-21/h8-15,20,22H,3-7,16H2,1-2H3/t20-,22-/m0/s1.
What are the key properties of (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone?
(4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone has a molecular weight of 434.00 g/mol, XLogP of 5.63, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone is sourced from PubChem (CID 135065560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).