C23H28ClNO3S — CID 135065560
(4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone (PubChem CID 135065560) has the molecular formula C23H28ClNO3S and a molecular weight of 434.00 g/mol. Its IUPAC name is (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone.
| Compound Name | (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone |
|---|---|
| PubChem CID | 135065560 |
| Molecular Formula | C23H28ClNO3S |
| Molecular Weight | 434.00 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (4-chlorophenyl)-[(2S,4S)-4-hexyl-1-(4-methylphenyl)sulfonylazetidin-2-yl]methanone |
| SMILES | CCCCCC[C@H]1C[C@@H](C(=O)c2ccc(Cl)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H28ClNO3S/c1-3-4-5-6-7-20-16-22(23(26)18-10-12-19(24)13-11-18)25(20)29(27,28)21-14-8-17(2)9-15-21/h8-15,20,22H,3-7,16H2,1-2H3/t20-,22-/m0/s1 |
| InChIKey | LVJHFVDKZZLIPN-UNMCSNQZSA-N |
| XLogP | 5.63 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.00 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|