C18H22F3NO3 — CID 135065754
tert-butyl 2-oxo-3-[[3-(trifluoromethyl)phenyl]methyl]piperidine-1-carboxylate (PubChem CID 135065754) has the molecular formula C18H22F3NO3 and a molecular weight of 357.37 g/mol. Its IUPAC name is tert-butyl 2-oxo-3-[[3-(trifluoromethyl)phenyl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-oxo-3-[[3-(trifluoromethyl)phenyl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 135065754 |
| Molecular Formula | C18H22F3NO3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | tert-butyl 2-oxo-3-[[3-(trifluoromethyl)phenyl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Cc2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C18H22F3NO3/c1-17(2,3)25-16(24)22-9-5-7-13(15(22)23)10-12-6-4-8-14(11-12)18(19,20)21/h4,6,8,11,13H,5,7,9-10H2,1-3H3 |
| InChIKey | MVSUKUOHZSERDS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |