C16H30OSi — CID 135066582
[(1R,5S,6R)-6-bicyclo[3.1.0]hex-2-enyl]methoxy-tri(propan-2-yl)silane (PubChem CID 135066582) has the molecular formula C16H30OSi and a molecular weight of 266.50 g/mol. Its IUPAC name is [(1R,5S,6R)-6-bicyclo[3.1.0]hex-2-enyl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(1R,5S,6R)-6-bicyclo[3.1.0]hex-2-enyl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 135066582 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | [(1R,5S,6R)-6-bicyclo[3.1.0]hex-2-enyl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@H]1[C@@H]2C=CC[C@@H]21)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H30OSi/c1-11(2)18(12(3)4,13(5)6)17-10-16-14-8-7-9-15(14)16/h7-8,11-16H,9-10H2,1-6H3/t14-,15+,16+/m1/s1 |
| InChIKey | HRYZMWFHBSPJPR-PMPSAXMXSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|