C15H15FO4 — CID 135066798
methyl (1R,3aS,6aR)-1-(2-fluorophenyl)-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate (PubChem CID 135066798) has the molecular formula C15H15FO4 and a molecular weight of 278.28 g/mol. Its IUPAC name is methyl (1R,3aS,6aR)-1-(2-fluorophenyl)-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate.
| Compound Name | methyl (1R,3aS,6aR)-1-(2-fluorophenyl)-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
|---|---|
| PubChem CID | 135066798 |
| Molecular Formula | C15H15FO4 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | methyl (1R,3aS,6aR)-1-(2-fluorophenyl)-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
| SMILES | COC(=O)[C@]12CCC[C@H]1[C@H](c1ccccc1F)OC2=O |
| InChI | InChI=1S/C15H15FO4/c1-19-13(17)15-8-4-6-10(15)12(20-14(15)18)9-5-2-3-7-11(9)16/h2-3,5,7,10,12H,4,6,8H2,1H3/t10-,12-,15-/m0/s1 |
| InChIKey | RZILMJGUDNNPLQ-WBIUFABUSA-N |
| XLogP | 2.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|