C13H26OSi — CID 135066873
cis-(1R,2S)-2-[(E)-3-trimethylsilylbut-1-enyl]cyclohexan-1-ol (PubChem CID 135066873) has the molecular formula C13H26OSi and a molecular weight of 226.44 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(E)-3-trimethylsilylbut-1-enyl]cyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-2-[(E)-3-trimethylsilylbut-1-enyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 135066873 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | cis-(1R,2S)-2-[(E)-3-trimethylsilylbut-1-enyl]cyclohexan-1-ol |
| SMILES | CC(/C=C/[C@@H]1CCCC[C@H]1O)[Si](C)(C)C |
| InChI | InChI=1S/C13H26OSi/c1-11(15(2,3)4)9-10-12-7-5-6-8-13(12)14/h9-14H,5-8H2,1-4H3/b10-9+/t11?,12-,13+/m0/s1 |
| InChIKey | AWEOIZLYWLGZGJ-SWUMAXRHSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|