C15H20O5 — CID 135067159
dimethyl (3S,3aS,7aS)-3-ethenyl-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate (PubChem CID 135067159) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is dimethyl (3S,3aS,7aS)-3-ethenyl-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate.
| Compound Name | dimethyl (3S,3aS,7aS)-3-ethenyl-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135067159 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | dimethyl (3S,3aS,7aS)-3-ethenyl-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OC)(C(=O)OC)[C@H]2CCCC(=O)[C@@H]12 |
| InChI | InChI=1S/C15H20O5/c1-4-9-8-15(13(17)19-2,14(18)20-3)10-6-5-7-11(16)12(9)10/h4,9-10,12H,1,5-8H2,2-3H3/t9-,10+,12+/m1/s1 |
| InChIKey | QGUCSFWLVOOYNZ-SCVCMEIPSA-N |
| XLogP | 1.51 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|