C19H24N2O2 — CID 135067536
tert-butyl (3R,3'R)-3'-ethenylspiro[indole-3,4'-piperidine]-1'-carboxylate (PubChem CID 135067536) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is tert-butyl (3R,3'R)-3'-ethenylspiro[indole-3,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl (3R,3'R)-3'-ethenylspiro[indole-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 135067536 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | tert-butyl (3R,3'R)-3'-ethenylspiro[indole-3,4'-piperidine]-1'-carboxylate |
| SMILES | C=C[C@H]1CN(C(=O)OC(C)(C)C)CC[C@@]12C=Nc1ccccc12 |
| InChI | InChI=1S/C19H24N2O2/c1-5-14-12-21(17(22)23-18(2,3)4)11-10-19(14)13-20-16-9-7-6-8-15(16)19/h5-9,13-14H,1,10-12H2,2-4H3/t14-,19+/m0/s1 |
| InChIKey | LSXSWEVYHXGILO-IFXJQAMLSA-N |
| XLogP | 4.08 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|