C11H12BrN — CID 135067592
5-[(2-bromophenyl)methyl]-3,4-dihydro-2H-pyrrole (PubChem CID 135067592) has the molecular formula C11H12BrN and a molecular weight of 238.13 g/mol. Its IUPAC name is 5-[(2-bromophenyl)methyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-[(2-bromophenyl)methyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 135067592 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 5-[(2-bromophenyl)methyl]-3,4-dihydro-2H-pyrrole |
| SMILES | Brc1ccccc1CC1=NCCC1 |
| InChI | InChI=1S/C11H12BrN/c12-11-6-2-1-4-9(11)8-10-5-3-7-13-10/h1-2,4,6H,3,5,7-8H2 |
| InChIKey | GUSYKHWJBLYMMH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |