C19H26O3 — CID 135067999
ethyl (1R,2S,6R,7S)-3-cyclohexyl-5-oxotricyclo[5.2.1.02,6]dec-3-ene-4-carboxylate (PubChem CID 135067999) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is ethyl (1R,2S,6R,7S)-3-cyclohexyl-5-oxotricyclo[5.2.1.02,6]dec-3-ene-4-carboxylate.
| Compound Name | ethyl (1R,2S,6R,7S)-3-cyclohexyl-5-oxotricyclo[5.2.1.02,6]dec-3-ene-4-carboxylate |
|---|---|
| PubChem CID | 135067999 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | ethyl (1R,2S,6R,7S)-3-cyclohexyl-5-oxotricyclo[5.2.1.02,6]dec-3-ene-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C2CCCCC2)[C@H]2[C@@H]3CC[C@@H](C3)[C@H]2C1=O |
| InChI | InChI=1S/C19H26O3/c1-2-22-19(21)17-14(11-6-4-3-5-7-11)15-12-8-9-13(10-12)16(15)18(17)20/h11-13,15-16H,2-10H2,1H3/t12-,13+,15-,16-/m1/s1 |
| InChIKey | LHCAMEIRPQVISQ-OCVGTWLNSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|