C23H26O2 — CID 135068197
(2R,3S,6S)-3-methyl-3-phenyl-2-(2-phenylethyl)-6-prop-2-enyloxan-4-one (PubChem CID 135068197) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2R,3S,6S)-3-methyl-3-phenyl-2-(2-phenylethyl)-6-prop-2-enyloxan-4-one.
| Compound Name | (2R,3S,6S)-3-methyl-3-phenyl-2-(2-phenylethyl)-6-prop-2-enyloxan-4-one |
|---|---|
| PubChem CID | 135068197 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (2R,3S,6S)-3-methyl-3-phenyl-2-(2-phenylethyl)-6-prop-2-enyloxan-4-one |
| SMILES | C=CC[C@H]1CC(=O)[C@@](C)(c2ccccc2)[C@@H](CCc2ccccc2)O1 |
| InChI | InChI=1S/C23H26O2/c1-3-10-20-17-21(24)23(2,19-13-8-5-9-14-19)22(25-20)16-15-18-11-6-4-7-12-18/h3-9,11-14,20,22H,1,10,15-17H2,2H3/t20-,22+,23+/m0/s1 |
| InChIKey | YTMDEDAKCDPCGF-MDNUFGMLSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|