C11H16O5 — CID 135068915
(2R,6'R)-6'-methoxy-2',2'-dimethylspiro[3H-furan-2,4'-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole] (PubChem CID 135068915) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (2R,6'R)-6'-methoxy-2',2'-dimethylspiro[3H-furan-2,4'-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole].
| Compound Name | (2R,6'R)-6'-methoxy-2',2'-dimethylspiro[3H-furan-2,4'-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole] |
|---|---|
| PubChem CID | 135068915 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (2R,6'R)-6'-methoxy-2',2'-dimethylspiro[3H-furan-2,4'-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole] |
| SMILES | CO[C@@H]1O[C@]2(CC=CO2)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C11H16O5/c1-10(2)14-7-8(15-10)11(5-4-6-13-11)16-9(7)12-3/h4,6-9H,5H2,1-3H3/t7?,8?,9-,11-/m1/s1 |
| InChIKey | LFEUQONWRMALAQ-RSWAIMACSA-N |
| XLogP | 1.14 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |