C12H16O5 — CID 135068965
diethyl (1R,2R,3R,4R,6R)-5-oxatricyclo[4.1.0.02,4]heptane-3,7-dicarboxylate (PubChem CID 135068965) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is diethyl (1R,2R,3R,4R,6R)-5-oxatricyclo[4.1.0.02,4]heptane-3,7-dicarboxylate.
| Compound Name | diethyl (1R,2R,3R,4R,6R)-5-oxatricyclo[4.1.0.02,4]heptane-3,7-dicarboxylate |
|---|---|
| PubChem CID | 135068965 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | diethyl (1R,2R,3R,4R,6R)-5-oxatricyclo[4.1.0.02,4]heptane-3,7-dicarboxylate |
| SMILES | CCOC(=O)C1[C@H]2[C@H]3[C@@H](O[C@@H]12)[C@@H]3C(=O)OCC |
| InChI | InChI=1S/C12H16O5/c1-3-15-11(13)7-5-6-8(12(14)16-4-2)10(6)17-9(5)7/h5-10H,3-4H2,1-2H3/t5-,6-,7-,8?,9-,10-/m1/s1 |
| InChIKey | CNAVNBAVRJMKQY-LNJKWQBGSA-N |
| XLogP | 0.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |