C14H20O5 — CID 11097540
diethyl (1S,2S,3S,4S,6S,7S)-4,6-dimethyl-5-oxatricyclo[4.1.0.02,4]heptane-3,7-dicarboxylate (PubChem CID 11097540) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is diethyl (1S,2S,3S,4S,6S,7S)-4,6-dimethyl-5-oxatricyclo[4.1.0.02,4]heptane-3,7-dicarboxylate.
| Compound Name | diethyl (1S,2S,3S,4S,6S,7S)-4,6-dimethyl-5-oxatricyclo[4.1.0.02,4]heptane-3,7-dicarboxylate |
|---|---|
| PubChem CID | 11097540 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | diethyl (1S,2S,3S,4S,6S,7S)-4,6-dimethyl-5-oxatricyclo[4.1.0.02,4]heptane-3,7-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2[C@H]3[C@H](C(=O)OCC)[C@@]3(C)O[C@@]21C |
| InChI | InChI=1S/C14H20O5/c1-5-17-11(15)9-7-8-10(12(16)18-6-2)14(8,4)19-13(7,9)3/h7-10H,5-6H2,1-4H3/t7-,8-,9+,10+,13-,14-/m0/s1 |
| InChIKey | OCTDEOQLSFTBJI-STBHKTOQSA-N |
| XLogP | 1.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |