C16H24O7 — CID 752046
diethyl (3R,4R,5R)-7,7-dimethyl-2-oxo-1,8-dioxaspiro[4.5]decane-3,4-dicarboxylate (PubChem CID 752046) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is diethyl (3R,4R,5R)-7,7-dimethyl-2-oxo-1,8-dioxaspiro[4.5]decane-3,4-dicarboxylate.
| Compound Name | diethyl (3R,4R,5R)-7,7-dimethyl-2-oxo-1,8-dioxaspiro[4.5]decane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 752046 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | diethyl (3R,4R,5R)-7,7-dimethyl-2-oxo-1,8-dioxaspiro[4.5]decane-3,4-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)O[C@@]2(CCOC(C)(C)C2)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C16H24O7/c1-5-20-12(17)10-11(14(19)21-6-2)16(23-13(10)18)7-8-22-15(3,4)9-16/h10-11H,5-9H2,1-4H3/t10-,11+,16-/m1/s1 |
| InChIKey | WJYLFABUDRLBIA-OHUAYANFSA-N |
| XLogP | 1.23 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|