C25H44O2Si — CID 135069831
tert-butyl-[[(8Z)-13-methoxy-16-methyl-5-tricyclo[11.3.1.05,16]heptadeca-1,8-dienyl]oxy]-dimethylsilane (PubChem CID 135069831) has the molecular formula C25H44O2Si and a molecular weight of 404.71 g/mol. Its IUPAC name is tert-butyl-[[(8Z)-13-methoxy-16-methyl-5-tricyclo[11.3.1.05,16]heptadeca-1,8-dienyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(8Z)-13-methoxy-16-methyl-5-tricyclo[11.3.1.05,16]heptadeca-1,8-dienyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 135069831 |
| Molecular Formula | C25H44O2Si |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | tert-butyl-[[(8Z)-13-methoxy-16-methyl-5-tricyclo[11.3.1.05,16]heptadeca-1,8-dienyl]oxy]-dimethylsilane |
| SMILES | COC12CCC/C=C\CCC3(O[Si](C)(C)C(C)(C)C)CCC=C(C1)C3(C)CC2 |
| InChI | InChI=1S/C25H44O2Si/c1-22(2,3)28(6,7)27-25-16-12-10-8-9-11-15-24(26-5)19-18-23(25,4)21(20-24)14-13-17-25/h8,10,14H,9,11-13,15-20H2,1-7H3/b10-8- |
| InChIKey | RGXAZRPWKNLKCE-NTMALXAHSA-N |
| XLogP | 7.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|