C31H35NO2Si — CID 135070409
bis(3,5-dimethylphenyl)-[(1S)-1-(4-methoxyphenyl)-2-pyridin-2-ylethoxy]-methylsilane (PubChem CID 135070409) has the molecular formula C31H35NO2Si and a molecular weight of 481.71 g/mol. Its IUPAC name is bis(3,5-dimethylphenyl)-[(1S)-1-(4-methoxyphenyl)-2-pyridin-2-ylethoxy]-methylsilane.
| Compound Name | bis(3,5-dimethylphenyl)-[(1S)-1-(4-methoxyphenyl)-2-pyridin-2-ylethoxy]-methylsilane |
|---|---|
| PubChem CID | 135070409 |
| Molecular Formula | C31H35NO2Si |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | bis(3,5-dimethylphenyl)-[(1S)-1-(4-methoxyphenyl)-2-pyridin-2-ylethoxy]-methylsilane |
| SMILES | COc1ccc([C@H](Cc2ccccn2)O[Si](C)(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C31H35NO2Si/c1-22-15-23(2)18-29(17-22)35(6,30-19-24(3)16-25(4)20-30)34-31(21-27-9-7-8-14-32-27)26-10-12-28(33-5)13-11-26/h7-20,31H,21H2,1-6H3/t31-/m0/s1 |
| InChIKey | YWPWYEIJZYZMCQ-HKBQPEDESA-N |
| XLogP | 6.01 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|