C18H24N2 — CID 61028897
1-(3,5-dimethylphenyl)-N-ethyl-3-pyridin-2-ylpropan-2-amine (PubChem CID 61028897) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-N-ethyl-3-pyridin-2-ylpropan-2-amine.
| Compound Name | 1-(3,5-dimethylphenyl)-N-ethyl-3-pyridin-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 61028897 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-N-ethyl-3-pyridin-2-ylpropan-2-amine |
| SMILES | CCNC(Cc1cc(C)cc(C)c1)Cc1ccccn1 |
| InChI | InChI=1S/C18H24N2/c1-4-19-18(13-17-7-5-6-8-20-17)12-16-10-14(2)9-15(3)11-16/h5-11,18-19H,4,12-13H2,1-3H3 |
| InChIKey | ZGWVJWCGRSKFLR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |