C17H14N2O3 — CID 135070489
1,6-dimethyl-3-phenyl-[1]benzofuro[3,2-d]pyrazole-5,8-diol (PubChem CID 135070489) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 1,6-dimethyl-3-phenyl-[1]benzofuro[3,2-d]pyrazole-5,8-diol.
| Compound Name | 1,6-dimethyl-3-phenyl-[1]benzofuro[3,2-d]pyrazole-5,8-diol |
|---|---|
| PubChem CID | 135070489 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1,6-dimethyl-3-phenyl-[1]benzofuro[3,2-d]pyrazole-5,8-diol |
| SMILES | Cc1cc(O)c2c(oc3c2c(C)nn3-c2ccccc2)c1O |
| InChI | InChI=1S/C17H14N2O3/c1-9-8-12(20)14-13-10(2)18-19(11-6-4-3-5-7-11)17(13)22-16(14)15(9)21/h3-8,20-21H,1-2H3 |
| InChIKey | REPPTIJRZGTVSZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|