About 1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one
1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one (PubChem CID 1021428) has the molecular formula C14H11IN2O2
and a molecular weight of 366.16 g/mol. Its IUPAC name is 1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one.
Molecular Properties
| Compound Name | 1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one |
| PubChem CID | 1021428 |
| Molecular Formula | C14H11IN2O2 |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one |
| SMILES | Cc1cc(=O)oc2c1c(C)nn2-c1ccc(I)cc1 |
| InChI | InChI=1S/C14H11IN2O2/c1-8-7-12(18)19-14-13(8)9(2)16-17(14)11-5-3-10(15)4-6-11/h3-7H,1-2H3 |
| InChIKey | BCRKDEFJVMIPAH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one?
The IUPAC name of 1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one (CID 1021428) is 1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one.
What is the SMILES notation for 1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one?
The canonical SMILES for 1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one is Cc1cc(=O)oc2c1c(C)nn2-c1ccc(I)cc1.
What is the InChIKey of 1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one?
The InChIKey is BCRKDEFJVMIPAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11IN2O2/c1-8-7-12(18)19-14-13(8)9(2)16-17(14)11-5-3-10(15)4-6-11/h3-7H,1-2H3.
What are the key properties of 1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one?
1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one has a molecular weight of 366.16 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-iodophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one is sourced from PubChem (CID 1021428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).