C16H16N2O2 — CID 700657
5-ethyl-3,4-dimethyl-1-phenylpyrano[3,2-d]pyrazol-6-one (PubChem CID 700657) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 5-ethyl-3,4-dimethyl-1-phenylpyrano[3,2-d]pyrazol-6-one.
| Compound Name | 5-ethyl-3,4-dimethyl-1-phenylpyrano[3,2-d]pyrazol-6-one |
|---|---|
| PubChem CID | 700657 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 5-ethyl-3,4-dimethyl-1-phenylpyrano[3,2-d]pyrazol-6-one |
| SMILES | CCc1c(C)c2c(C)nn(-c3ccccc3)c2oc1=O |
| InChI | InChI=1S/C16H16N2O2/c1-4-13-10(2)14-11(3)17-18(15(14)20-16(13)19)12-8-6-5-7-9-12/h5-9H,4H2,1-3H3 |
| InChIKey | DHNVBODAHSONDJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |