C14H11ClN2O2 — CID 696875
1-(4-chlorophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one (PubChem CID 696875) has the molecular formula C14H11ClN2O2 and a molecular weight of 274.71 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one.
| Compound Name | 1-(4-chlorophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one |
|---|---|
| PubChem CID | 696875 |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one |
| SMILES | Cc1cc(=O)oc2c1c(C)nn2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H11ClN2O2/c1-8-7-12(18)19-14-13(8)9(2)16-17(14)11-5-3-10(15)4-6-11/h3-7H,1-2H3 |
| InChIKey | YUUPOEIPCKZQSL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |