C16H28O2 — CID 135071679
(1R,2S,3R)-2-[(3S)-3-hydroxy-2,2-dimethylpent-4-enyl]-1-methyl-3-prop-1-en-2-ylcyclopentan-1-ol (PubChem CID 135071679) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (1R,2S,3R)-2-[(3S)-3-hydroxy-2,2-dimethylpent-4-enyl]-1-methyl-3-prop-1-en-2-ylcyclopentan-1-ol.
| Compound Name | (1R,2S,3R)-2-[(3S)-3-hydroxy-2,2-dimethylpent-4-enyl]-1-methyl-3-prop-1-en-2-ylcyclopentan-1-ol |
|---|---|
| PubChem CID | 135071679 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (1R,2S,3R)-2-[(3S)-3-hydroxy-2,2-dimethylpent-4-enyl]-1-methyl-3-prop-1-en-2-ylcyclopentan-1-ol |
| SMILES | C=C[C@H](O)C(C)(C)C[C@H]1[C@H](C(=C)C)CC[C@@]1(C)O |
| InChI | InChI=1S/C16H28O2/c1-7-14(17)15(4,5)10-13-12(11(2)3)8-9-16(13,6)18/h7,12-14,17-18H,1-2,8-10H2,3-6H3/t12-,13-,14-,16+/m0/s1 |
| InChIKey | CNGGFNXAWSDPBN-RZLSGREXSA-N |
| XLogP | 3.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|