C14H22OSi — CID 135071829
dimethyl-nona-2,4-diynoxy-prop-2-enylsilane (PubChem CID 135071829) has the molecular formula C14H22OSi and a molecular weight of 234.41 g/mol. Its IUPAC name is dimethyl-nona-2,4-diynoxy-prop-2-enylsilane.
| Compound Name | dimethyl-nona-2,4-diynoxy-prop-2-enylsilane |
|---|---|
| PubChem CID | 135071829 |
| Molecular Formula | C14H22OSi |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | dimethyl-nona-2,4-diynoxy-prop-2-enylsilane |
| SMILES | C=CC[Si](C)(C)OCC#CC#CCCCC |
| InChI | InChI=1S/C14H22OSi/c1-5-7-8-9-10-11-12-13-15-16(3,4)14-6-2/h6H,2,5,7-8,13-14H2,1,3-4H3 |
| InChIKey | MXLSNAOXMIAKTF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|