C23H48O2Si2 — CID 135072279
tert-butyl-[[2-[[tert-butyl(dimethyl)silyl]methoxymethyl]-2-prop-2-enylpent-4-enoxy]methyl]-dimethylsilane (PubChem CID 135072279) has the molecular formula C23H48O2Si2 and a molecular weight of 412.81 g/mol. Its IUPAC name is tert-butyl-[[2-[[tert-butyl(dimethyl)silyl]methoxymethyl]-2-prop-2-enylpent-4-enoxy]methyl]-dimethylsilane.
| Compound Name | tert-butyl-[[2-[[tert-butyl(dimethyl)silyl]methoxymethyl]-2-prop-2-enylpent-4-enoxy]methyl]-dimethylsilane |
|---|---|
| PubChem CID | 135072279 |
| Molecular Formula | C23H48O2Si2 |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | tert-butyl-[[2-[[tert-butyl(dimethyl)silyl]methoxymethyl]-2-prop-2-enylpent-4-enoxy]methyl]-dimethylsilane |
| SMILES | C=CCC(CC=C)(COC[Si](C)(C)C(C)(C)C)COC[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O2Si2/c1-13-15-23(16-14-2,17-24-19-26(9,10)21(3,4)5)18-25-20-27(11,12)22(6,7)8/h13-14H,1-2,15-20H2,3-12H3 |
| InChIKey | PHSVJGRNUJCEMB-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|