C20H26O5 — CID 135072529
ethyl 2-[4-ethoxy-1-[(4-methoxyphenyl)methyl]-2-oxocyclohex-3-en-1-yl]acetate (PubChem CID 135072529) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is ethyl 2-[4-ethoxy-1-[(4-methoxyphenyl)methyl]-2-oxocyclohex-3-en-1-yl]acetate.
| Compound Name | ethyl 2-[4-ethoxy-1-[(4-methoxyphenyl)methyl]-2-oxocyclohex-3-en-1-yl]acetate |
|---|---|
| PubChem CID | 135072529 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | ethyl 2-[4-ethoxy-1-[(4-methoxyphenyl)methyl]-2-oxocyclohex-3-en-1-yl]acetate |
| SMILES | CCOC(=O)CC1(Cc2ccc(OC)cc2)CCC(OCC)=CC1=O |
| InChI | InChI=1S/C20H26O5/c1-4-24-17-10-11-20(18(21)12-17,14-19(22)25-5-2)13-15-6-8-16(23-3)9-7-15/h6-9,12H,4-5,10-11,13-14H2,1-3H3 |
| InChIKey | DQFAZCSRBVVEJK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |