C22H31NO6 — CID 10621305
methyl 3-[(1R)-1-[[4-[2-(ethoxycarbonylamino)ethoxy]phenyl]methyl]-2-oxocyclohexyl]propanoate (PubChem CID 10621305) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is methyl 3-[(1R)-1-[[4-[2-(ethoxycarbonylamino)ethoxy]phenyl]methyl]-2-oxocyclohexyl]propanoate.
| Compound Name | methyl 3-[(1R)-1-[[4-[2-(ethoxycarbonylamino)ethoxy]phenyl]methyl]-2-oxocyclohexyl]propanoate |
|---|---|
| PubChem CID | 10621305 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | methyl 3-[(1R)-1-[[4-[2-(ethoxycarbonylamino)ethoxy]phenyl]methyl]-2-oxocyclohexyl]propanoate |
| SMILES | CCOC(=O)NCCOc1ccc(C[C@]2(CCC(=O)OC)CCCCC2=O)cc1 |
| InChI | InChI=1S/C22H31NO6/c1-3-28-21(26)23-14-15-29-18-9-7-17(8-10-18)16-22(13-11-20(25)27-2)12-5-4-6-19(22)24/h7-10H,3-6,11-16H2,1-2H3,(H,23,26)/t22-/m1/s1 |
| InChIKey | YDBUPWMUOFMFJK-JOCHJYFZSA-N |
| XLogP | 3.44 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|