C36H59NO5 — CID 91285633
[2-[[4-[2-(ethoxycarbonylamino)ethoxy]phenyl]methyl]cyclohexyl] octadec-9-enoate (PubChem CID 91285633) has the molecular formula C36H59NO5 and a molecular weight of 585.87 g/mol. Its IUPAC name is [2-[[4-[2-(ethoxycarbonylamino)ethoxy]phenyl]methyl]cyclohexyl] octadec-9-enoate.
| Compound Name | [2-[[4-[2-(ethoxycarbonylamino)ethoxy]phenyl]methyl]cyclohexyl] octadec-9-enoate |
|---|---|
| PubChem CID | 91285633 |
| Molecular Formula | C36H59NO5 |
| Molecular Weight | 585.87 g/mol |
| Exact Mass | 585.44 |
| IUPAC Name | [2-[[4-[2-(ethoxycarbonylamino)ethoxy]phenyl]methyl]cyclohexyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC1CCCCC1Cc1ccc(OCCNC(=O)OCC)cc1 |
| InChI | InChI=1S/C36H59NO5/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-35(38)42-34-22-20-19-21-32(34)30-31-24-26-33(27-25-31)41-29-28-37-36(39)40-4-2/h11-12,24-27,32,34H,3-10,13-23,28-30H2,1-2H3,(H,37,39) |
| InChIKey | FOWQPLRJAYKPMU-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.87 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|