C19H33NO4 — CID 142063474
methyl 5-[[(3Z,5E)-dodeca-3,5-dienyl]carbamoyloxy]pentanoate (PubChem CID 142063474) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is methyl 5-[[(3Z,5E)-dodeca-3,5-dienyl]carbamoyloxy]pentanoate.
| Compound Name | methyl 5-[[(3Z,5E)-dodeca-3,5-dienyl]carbamoyloxy]pentanoate |
|---|---|
| PubChem CID | 142063474 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | methyl 5-[[(3Z,5E)-dodeca-3,5-dienyl]carbamoyloxy]pentanoate |
| SMILES | CCCCCC/C=C/C=C\CCNC(=O)OCCCCC(=O)OC |
| InChI | InChI=1S/C19H33NO4/c1-3-4-5-6-7-8-9-10-11-13-16-20-19(22)24-17-14-12-15-18(21)23-2/h8-11H,3-7,12-17H2,1-2H3,(H,20,22)/b9-8+,11-10- |
| InChIKey | XUVDPRRHOXKUPG-OCBXPSTGSA-N |
| XLogP | 4.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|