C18H24N4O4 — CID 135072785
N-cyclohexyl-2-[(4-nitrophenyl)carbamoylamino]-N-prop-2-enylacetamide (PubChem CID 135072785) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-cyclohexyl-2-[(4-nitrophenyl)carbamoylamino]-N-prop-2-enylacetamide.
| Compound Name | N-cyclohexyl-2-[(4-nitrophenyl)carbamoylamino]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 135072785 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-cyclohexyl-2-[(4-nitrophenyl)carbamoylamino]-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)CNC(=O)Nc1ccc([N+](=O)[O-])cc1)C1CCCCC1 |
| InChI | InChI=1S/C18H24N4O4/c1-2-12-21(15-6-4-3-5-7-15)17(23)13-19-18(24)20-14-8-10-16(11-9-14)22(25)26/h2,8-11,15H,1,3-7,12-13H2,(H2,19,20,24) |
| InChIKey | QIIFAIILMOTMRG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|