C8H5N4O- — CID 135072928
(4-oxo-1H-1,7-naphthyridin-3-yl)iminoazanide (PubChem CID 135072928) has the molecular formula C8H5N4O- and a molecular weight of 173.16 g/mol. Its IUPAC name is (4-oxo-1H-1,7-naphthyridin-3-yl)iminoazanide.
| Compound Name | (4-oxo-1H-1,7-naphthyridin-3-yl)iminoazanide |
|---|---|
| PubChem CID | 135072928 |
| Molecular Formula | C8H5N4O- |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | (4-oxo-1H-1,7-naphthyridin-3-yl)iminoazanide |
| SMILES | [N-]=Nc1c[nH]c2cnccc2c1=O |
| InChI | InChI=1S/C8H5N4O/c9-12-7-4-11-6-3-10-2-1-5(6)8(7)13/h1-4H,(H,11,13)/q-1 |
| InChIKey | PNJIHZFSASPEGK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|