C27H42O4 — CID 135073368
[(2E,6E,10E,14E)-17-(3,3-dimethyloxiran-2-yl)-3,7,11,15-tetramethyl-8-oxoheptadeca-2,6,10,14-tetraenyl] acetate (PubChem CID 135073368) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is [(2E,6E,10E,14E)-17-(3,3-dimethyloxiran-2-yl)-3,7,11,15-tetramethyl-8-oxoheptadeca-2,6,10,14-tetraenyl] acetate.
| Compound Name | [(2E,6E,10E,14E)-17-(3,3-dimethyloxiran-2-yl)-3,7,11,15-tetramethyl-8-oxoheptadeca-2,6,10,14-tetraenyl] acetate |
|---|---|
| PubChem CID | 135073368 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | [(2E,6E,10E,14E)-17-(3,3-dimethyloxiran-2-yl)-3,7,11,15-tetramethyl-8-oxoheptadeca-2,6,10,14-tetraenyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)C(=O)C/C=C(\C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C27H42O4/c1-20(10-8-11-21(2)15-17-26-27(6,7)31-26)14-16-25(29)23(4)13-9-12-22(3)18-19-30-24(5)28/h11,13-14,18,26H,8-10,12,15-17,19H2,1-7H3/b20-14+,21-11+,22-18+,23-13+ |
| InChIKey | SIRNSTMKRAIVQA-XCVQVYSTSA-N |
| XLogP | 6.81 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|