C27H22O3 — CID 135073646
[7-(4-methoxyphenyl)-3-phenylhepta-1,6-diyn-3-yl] benzoate (PubChem CID 135073646) has the molecular formula C27H22O3 and a molecular weight of 394.47 g/mol. Its IUPAC name is [7-(4-methoxyphenyl)-3-phenylhepta-1,6-diyn-3-yl] benzoate.
| Compound Name | [7-(4-methoxyphenyl)-3-phenylhepta-1,6-diyn-3-yl] benzoate |
|---|---|
| PubChem CID | 135073646 |
| Molecular Formula | C27H22O3 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | [7-(4-methoxyphenyl)-3-phenylhepta-1,6-diyn-3-yl] benzoate |
| SMILES | C#CC(CCC#Cc1ccc(OC)cc1)(OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22O3/c1-3-27(24-15-8-5-9-16-24,30-26(28)23-13-6-4-7-14-23)21-11-10-12-22-17-19-25(29-2)20-18-22/h1,4-9,13-20H,11,21H2,2H3 |
| InChIKey | JFUWNELGYMQFAU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|