C20H27BrN2O2 — CID 135073818
tert-butyl N-[2-[6-bromo-1-(3-methylbut-2-enyl)indol-3-yl]ethyl]carbamate (PubChem CID 135073818) has the molecular formula C20H27BrN2O2 and a molecular weight of 407.35 g/mol. Its IUPAC name is tert-butyl N-[2-[6-bromo-1-(3-methylbut-2-enyl)indol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[6-bromo-1-(3-methylbut-2-enyl)indol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 135073818 |
| Molecular Formula | C20H27BrN2O2 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | tert-butyl N-[2-[6-bromo-1-(3-methylbut-2-enyl)indol-3-yl]ethyl]carbamate |
| SMILES | CC(C)=CCn1cc(CCNC(=O)OC(C)(C)C)c2ccc(Br)cc21 |
| InChI | InChI=1S/C20H27BrN2O2/c1-14(2)9-11-23-13-15(17-7-6-16(21)12-18(17)23)8-10-22-19(24)25-20(3,4)5/h6-7,9,12-13H,8,10-11H2,1-5H3,(H,22,24) |
| InChIKey | HBRARDOLLNYCDC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|