C12H18O6 — CID 135074640
dimethyl 2-[(Z)-4-hydroxybut-2-enyl]-2-(3-oxopropyl)propanedioate (PubChem CID 135074640) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is dimethyl 2-[(Z)-4-hydroxybut-2-enyl]-2-(3-oxopropyl)propanedioate.
| Compound Name | dimethyl 2-[(Z)-4-hydroxybut-2-enyl]-2-(3-oxopropyl)propanedioate |
|---|---|
| PubChem CID | 135074640 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | dimethyl 2-[(Z)-4-hydroxybut-2-enyl]-2-(3-oxopropyl)propanedioate |
| SMILES | COC(=O)C(C/C=C\CO)(CCC=O)C(=O)OC |
| InChI | InChI=1S/C12H18O6/c1-17-10(15)12(7-5-9-14,11(16)18-2)6-3-4-8-13/h3-4,9,13H,5-8H2,1-2H3/b4-3- |
| InChIKey | ZFGJMQYFLNUUIE-ARJAWSKDSA-N |
| XLogP | 0.24 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|