C22H11ClF5NO2 — CID 135074868
[(Z)-[(E)-1-(2-chlorophenyl)-3-phenylprop-2-enylidene]amino] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 135074868) has the molecular formula C22H11ClF5NO2 and a molecular weight of 451.78 g/mol. Its IUPAC name is [(Z)-[(E)-1-(2-chlorophenyl)-3-phenylprop-2-enylidene]amino] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [(Z)-[(E)-1-(2-chlorophenyl)-3-phenylprop-2-enylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 135074868 |
| Molecular Formula | C22H11ClF5NO2 |
| Molecular Weight | 451.78 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | [(Z)-[(E)-1-(2-chlorophenyl)-3-phenylprop-2-enylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | O=C(O/N=C(/C=C/c1ccccc1)c1ccccc1Cl)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H11ClF5NO2/c23-14-9-5-4-8-13(14)15(11-10-12-6-2-1-3-7-12)29-31-22(30)16-17(24)19(26)21(28)20(27)18(16)25/h1-11H/b11-10+,29-15- |
| InChIKey | AEUUTBYHVIFQLI-SDHBTPFWSA-N |
| XLogP | 6.31 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.78 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|