C15H20INO — CID 135075380
2-[2-(2-iodophenyl)-2-methylpropyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 135075380) has the molecular formula C15H20INO and a molecular weight of 357.24 g/mol. Its IUPAC name is 2-[2-(2-iodophenyl)-2-methylpropyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[2-(2-iodophenyl)-2-methylpropyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 135075380 |
| Molecular Formula | C15H20INO |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 2-[2-(2-iodophenyl)-2-methylpropyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(CC(C)(C)c2ccccc2I)=N1 |
| InChI | InChI=1S/C15H20INO/c1-14(2,11-7-5-6-8-12(11)16)9-13-17-15(3,4)10-18-13/h5-8H,9-10H2,1-4H3 |
| InChIKey | NMZREVHZELZXFE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|