About diphenyl 1-pyridin-4-ylethenyl phosphate
diphenyl 1-pyridin-4-ylethenyl phosphate (PubChem CID 135076313) has the molecular formula C19H16NO4P
and a molecular weight of 353.31 g/mol. Its IUPAC name is diphenyl 1-pyridin-4-ylethenyl phosphate.
Molecular Properties
| Compound Name | diphenyl 1-pyridin-4-ylethenyl phosphate |
| PubChem CID | 135076313 |
| Molecular Formula | C19H16NO4P |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | diphenyl 1-pyridin-4-ylethenyl phosphate |
| SMILES | C=C(OP(=O)(Oc1ccccc1)Oc1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C19H16NO4P/c1-16(17-12-14-20-15-13-17)22-25(21,23-18-8-4-2-5-9-18)24-19-10-6-3-7-11-19/h2-15H,1H2 |
| InChIKey | CAICFIHTDPBKGA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenyl 1-pyridin-4-ylethenyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl 1-pyridin-4-ylethenyl phosphate?
The IUPAC name of diphenyl 1-pyridin-4-ylethenyl phosphate (CID 135076313) is diphenyl 1-pyridin-4-ylethenyl phosphate.
What is the SMILES notation for diphenyl 1-pyridin-4-ylethenyl phosphate?
The canonical SMILES for diphenyl 1-pyridin-4-ylethenyl phosphate is C=C(OP(=O)(Oc1ccccc1)Oc1ccccc1)c1ccncc1.
What is the InChIKey of diphenyl 1-pyridin-4-ylethenyl phosphate?
The InChIKey is CAICFIHTDPBKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16NO4P/c1-16(17-12-14-20-15-13-17)22-25(21,23-18-8-4-2-5-9-18)24-19-10-6-3-7-11-19/h2-15H,1H2.
What are the key properties of diphenyl 1-pyridin-4-ylethenyl phosphate?
diphenyl 1-pyridin-4-ylethenyl phosphate has a molecular weight of 353.31 g/mol, XLogP of 5.34, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl 1-pyridin-4-ylethenyl phosphate is sourced from PubChem (CID 135076313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).