C24H22N3O3P — CID 50907501
(3E,5E)-1-[methyl(phenoxy)phosphoryl]-3,5-bis(pyridin-4-ylmethylidene)piperidin-4-one (PubChem CID 50907501) has the molecular formula C24H22N3O3P and a molecular weight of 431.43 g/mol. Its IUPAC name is (3E,5E)-1-[methyl(phenoxy)phosphoryl]-3,5-bis(pyridin-4-ylmethylidene)piperidin-4-one.
| Compound Name | (3E,5E)-1-[methyl(phenoxy)phosphoryl]-3,5-bis(pyridin-4-ylmethylidene)piperidin-4-one |
|---|---|
| PubChem CID | 50907501 |
| Molecular Formula | C24H22N3O3P |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (3E,5E)-1-[methyl(phenoxy)phosphoryl]-3,5-bis(pyridin-4-ylmethylidene)piperidin-4-one |
| SMILES | CP(=O)(Oc1ccccc1)N1C/C(=C\c2ccncc2)C(=O)/C(=C/c2ccncc2)C1 |
| InChI | InChI=1S/C24H22N3O3P/c1-31(29,30-23-5-3-2-4-6-23)27-17-21(15-19-7-11-25-12-8-19)24(28)22(18-27)16-20-9-13-26-14-10-20/h2-16H,17-18H2,1H3/b21-15+,22-16+ |
| InChIKey | BYBHYLUUVYYCMR-YHARCJFQSA-N |
| XLogP | 4.73 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|